C27H24N2O4 — CID 167879612
(E)-2-methyl-1,4-bis(5-oxo-2,2a,3,4-tetrahydrobenzo[cd]indol-1-yl)but-2-ene-1,4-dione (PubChem CID 167879612) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is (E)-2-methyl-1,4-bis(5-oxo-2,2a,3,4-tetrahydrobenzo[cd]indol-1-yl)but-2-ene-1,4-dione.
| Compound Name | (E)-2-methyl-1,4-bis(5-oxo-2,2a,3,4-tetrahydrobenzo[cd]indol-1-yl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 167879612 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (E)-2-methyl-1,4-bis(5-oxo-2,2a,3,4-tetrahydrobenzo[cd]indol-1-yl)but-2-ene-1,4-dione |
| SMILES | C/C(=C\C(=O)N1CC2CCC(=O)c3cccc1c32)C(=O)N1CC2CCC(=O)c3cccc1c32 |
| InChI | InChI=1S/C27H24N2O4/c1-15(27(33)29-14-17-9-11-23(31)19-5-3-7-21(29)26(17)19)12-24(32)28-13-16-8-10-22(30)18-4-2-6-20(28)25(16)18/h2-7,12,16-17H,8-11,13-14H2,1H3/b15-12+ |
| InChIKey | JAAHLQPIRGNMPC-NTCAYCPXSA-N |
| XLogP | 4.15 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|