C19H18FN3 — CID 167879943
1-(4-fluorophenyl)-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]cyclopropan-1-amine (PubChem CID 167879943) has the molecular formula C19H18FN3 and a molecular weight of 307.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]cyclopropan-1-amine.
| Compound Name | 1-(4-fluorophenyl)-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 167879943 |
| Molecular Formula | C19H18FN3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(3-phenyl-1H-pyrazol-5-yl)methyl]cyclopropan-1-amine |
| SMILES | Fc1ccc(C2(NCc3cc(-c4ccccc4)n[nH]3)CC2)cc1 |
| InChI | InChI=1S/C19H18FN3/c20-16-8-6-15(7-9-16)19(10-11-19)21-13-17-12-18(23-22-17)14-4-2-1-3-5-14/h1-9,12,21H,10-11,13H2,(H,22,23) |
| InChIKey | XGBKHZUNIXTZOB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |