C18H19BN2O6S — CID 167880311
[4-[5-(dimethylsulfamoyl)-1,3-dihydroisoindole-2-carbonyl]-2-formylphenyl]boronic acid (PubChem CID 167880311) has the molecular formula C18H19BN2O6S and a molecular weight of 402.24 g/mol. Its IUPAC name is [4-[5-(dimethylsulfamoyl)-1,3-dihydroisoindole-2-carbonyl]-2-formylphenyl]boronic acid.
| Compound Name | [4-[5-(dimethylsulfamoyl)-1,3-dihydroisoindole-2-carbonyl]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 167880311 |
| Molecular Formula | C18H19BN2O6S |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | [4-[5-(dimethylsulfamoyl)-1,3-dihydroisoindole-2-carbonyl]-2-formylphenyl]boronic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)CN(C(=O)c1ccc(B(O)O)c(C=O)c1)C2 |
| InChI | InChI=1S/C18H19BN2O6S/c1-20(2)28(26,27)16-5-3-13-9-21(10-14(13)8-16)18(23)12-4-6-17(19(24)25)15(7-12)11-22/h3-8,11,24-25H,9-10H2,1-2H3 |
| InChIKey | UPLDXCYEJVXYBS-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|