C14H14F2N2O3S — CID 167880342
N-(3-ethoxy-2-pyridinyl)-2,3-difluoro-4-methylbenzenesulfonamide (PubChem CID 167880342) has the molecular formula C14H14F2N2O3S and a molecular weight of 328.34 g/mol. Its IUPAC name is N-(3-ethoxy-2-pyridinyl)-2,3-difluoro-4-methylbenzenesulfonamide.
| Compound Name | N-(3-ethoxy-2-pyridinyl)-2,3-difluoro-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 167880342 |
| Molecular Formula | C14H14F2N2O3S |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-(3-ethoxy-2-pyridinyl)-2,3-difluoro-4-methylbenzenesulfonamide |
| SMILES | CCOc1cccnc1NS(=O)(=O)c1ccc(C)c(F)c1F |
| InChI | InChI=1S/C14H14F2N2O3S/c1-3-21-10-5-4-8-17-14(10)18-22(19,20)11-7-6-9(2)12(15)13(11)16/h4-8H,3H2,1-2H3,(H,17,18) |
| InChIKey | XHTMWHMCHBBZKB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |