C18H17N3O4 — CID 167881813
2-[(2-cyclopropyl-1-methylbenzimidazol-5-yl)methylcarbamoyl]furan-3-carboxylic acid (PubChem CID 167881813) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[(2-cyclopropyl-1-methylbenzimidazol-5-yl)methylcarbamoyl]furan-3-carboxylic acid.
| Compound Name | 2-[(2-cyclopropyl-1-methylbenzimidazol-5-yl)methylcarbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 167881813 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[(2-cyclopropyl-1-methylbenzimidazol-5-yl)methylcarbamoyl]furan-3-carboxylic acid |
| SMILES | Cn1c(C2CC2)nc2cc(CNC(=O)c3occc3C(=O)O)ccc21 |
| InChI | InChI=1S/C18H17N3O4/c1-21-14-5-2-10(8-13(14)20-16(21)11-3-4-11)9-19-17(22)15-12(18(23)24)6-7-25-15/h2,5-8,11H,3-4,9H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | WQEMJCBWKHPNJA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |