C17H19ClN2O2 — CID 167881997
2-(4-chloro-3-pyridinyl)-N-[3-(4-methylphenoxy)propyl]acetamide (PubChem CID 167881997) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 2-(4-chloro-3-pyridinyl)-N-[3-(4-methylphenoxy)propyl]acetamide.
| Compound Name | 2-(4-chloro-3-pyridinyl)-N-[3-(4-methylphenoxy)propyl]acetamide |
|---|---|
| PubChem CID | 167881997 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-(4-chloro-3-pyridinyl)-N-[3-(4-methylphenoxy)propyl]acetamide |
| SMILES | Cc1ccc(OCCCNC(=O)Cc2cnccc2Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-13-3-5-15(6-4-13)22-10-2-8-20-17(21)11-14-12-19-9-7-16(14)18/h3-7,9,12H,2,8,10-11H2,1H3,(H,20,21) |
| InChIKey | PZBPWOHOZKKGKM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|