C11H13N5O — CID 16788251
N-(4-aminophenyl)-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 16788251) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-(4-aminophenyl)-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 16788251 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-(4-aminophenyl)-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(N)cc1)n1cncn1 |
| InChI | InChI=1S/C11H13N5O/c1-8(16-7-13-6-14-16)11(17)15-10-4-2-9(12)3-5-10/h2-8H,12H2,1H3,(H,15,17) |
| InChIKey | JIILXZLKCRZMIC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|