C14H15N7O3 — CID 4846985
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 4846985) has the molecular formula C14H15N7O3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4846985 |
| Molecular Formula | C14H15N7O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | CC1(C)NC(=O)N(CC(=O)Nc2ccc(-n3cnnn3)cc2)C1=O |
| InChI | InChI=1S/C14H15N7O3/c1-14(2)12(23)20(13(24)17-14)7-11(22)16-9-3-5-10(6-4-9)21-8-15-18-19-21/h3-6,8H,7H2,1-2H3,(H,16,22)(H,17,24) |
| InChIKey | NNQGJMOQXLUMCU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|