C21H26N4O3 — CID 167885279
N'-(3-methoxy-2,5-dimethylphenyl)-N-(4-piperazin-1-ylphenyl)oxamide (PubChem CID 167885279) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N'-(3-methoxy-2,5-dimethylphenyl)-N-(4-piperazin-1-ylphenyl)oxamide.
| Compound Name | N'-(3-methoxy-2,5-dimethylphenyl)-N-(4-piperazin-1-ylphenyl)oxamide |
|---|---|
| PubChem CID | 167885279 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N'-(3-methoxy-2,5-dimethylphenyl)-N-(4-piperazin-1-ylphenyl)oxamide |
| SMILES | COc1cc(C)cc(NC(=O)C(=O)Nc2ccc(N3CCNCC3)cc2)c1C |
| InChI | InChI=1S/C21H26N4O3/c1-14-12-18(15(2)19(13-14)28-3)24-21(27)20(26)23-16-4-6-17(7-5-16)25-10-8-22-9-11-25/h4-7,12-13,22H,8-11H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | VALLUNISVQVTGC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|