C19H21N3O4 — CID 167887560
2-[[1-(2-cyclopropylpyrimidine-5-carbonyl)piperidin-4-yl]methyl]furan-3-carboxylic acid (PubChem CID 167887560) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[[1-(2-cyclopropylpyrimidine-5-carbonyl)piperidin-4-yl]methyl]furan-3-carboxylic acid.
| Compound Name | 2-[[1-(2-cyclopropylpyrimidine-5-carbonyl)piperidin-4-yl]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 167887560 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[[1-(2-cyclopropylpyrimidine-5-carbonyl)piperidin-4-yl]methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1ccoc1CC1CCN(C(=O)c2cnc(C3CC3)nc2)CC1 |
| InChI | InChI=1S/C19H21N3O4/c23-18(14-10-20-17(21-11-14)13-1-2-13)22-6-3-12(4-7-22)9-16-15(19(24)25)5-8-26-16/h5,8,10-13H,1-4,6-7,9H2,(H,24,25) |
| InChIKey | IIWIJBRYVVLRKS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |