C13H14F3N3O2 — CID 95509697
(2-cyclopropylpyrimidin-5-yl)-[(2S)-2-(trifluoromethyl)morpholin-4-yl]methanone (PubChem CID 95509697) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is (2-cyclopropylpyrimidin-5-yl)-[(2S)-2-(trifluoromethyl)morpholin-4-yl]methanone.
| Compound Name | (2-cyclopropylpyrimidin-5-yl)-[(2S)-2-(trifluoromethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 95509697 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2-cyclopropylpyrimidin-5-yl)-[(2S)-2-(trifluoromethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1cnc(C2CC2)nc1)N1CCO[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C13H14F3N3O2/c14-13(15,16)10-7-19(3-4-21-10)12(20)9-5-17-11(18-6-9)8-1-2-8/h5-6,8,10H,1-4,7H2/t10-/m0/s1 |
| InChIKey | AOPGRCZIVSWMFY-JTQLQIEISA-N |
| XLogP | 1.76 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |