C15H14F3N3O2 — CID 95549395
[3-(1H-pyrazol-4-yl)phenyl]-[(2R)-2-(trifluoromethyl)morpholin-4-yl]methanone (PubChem CID 95549395) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is [3-(1H-pyrazol-4-yl)phenyl]-[(2R)-2-(trifluoromethyl)morpholin-4-yl]methanone.
| Compound Name | [3-(1H-pyrazol-4-yl)phenyl]-[(2R)-2-(trifluoromethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 95549395 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [3-(1H-pyrazol-4-yl)phenyl]-[(2R)-2-(trifluoromethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1cccc(-c2cn[nH]c2)c1)N1CCO[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C15H14F3N3O2/c16-15(17,18)13-9-21(4-5-23-13)14(22)11-3-1-2-10(6-11)12-7-19-20-8-12/h1-3,6-8,13H,4-5,9H2,(H,19,20)/t13-/m1/s1 |
| InChIKey | BZUHJVDAFKHSGU-CYBMUJFWSA-N |
| XLogP | 2.48 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |