C20H16F3NO2 — CID 95539252
anthracen-9-yl-[(2S)-2-(trifluoromethyl)morpholin-4-yl]methanone (PubChem CID 95539252) has the molecular formula C20H16F3NO2 and a molecular weight of 359.35 g/mol. Its IUPAC name is anthracen-9-yl-[(2S)-2-(trifluoromethyl)morpholin-4-yl]methanone.
| Compound Name | anthracen-9-yl-[(2S)-2-(trifluoromethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 95539252 |
| Molecular Formula | C20H16F3NO2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | anthracen-9-yl-[(2S)-2-(trifluoromethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1c2ccccc2cc2ccccc12)N1CCO[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C20H16F3NO2/c21-20(22,23)17-12-24(9-10-26-17)19(25)18-15-7-3-1-5-13(15)11-14-6-2-4-8-16(14)18/h1-8,11,17H,9-10,12H2/t17-/m0/s1 |
| InChIKey | PJOGTDOWIBXEOJ-KRWDZBQOSA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|