C14H18ClF3N2O2 — CID 154892255
2-(benzylamino)-1-[2-(trifluoromethyl)morpholin-4-yl]ethanone;hydrochloride (PubChem CID 154892255) has the molecular formula C14H18ClF3N2O2 and a molecular weight of 338.76 g/mol. Its IUPAC name is 2-(benzylamino)-1-[2-(trifluoromethyl)morpholin-4-yl]ethanone;hydrochloride.
| Compound Name | 2-(benzylamino)-1-[2-(trifluoromethyl)morpholin-4-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 154892255 |
| Molecular Formula | C14H18ClF3N2O2 |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-(benzylamino)-1-[2-(trifluoromethyl)morpholin-4-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(CNCc1ccccc1)N1CCOC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H17F3N2O2.ClH/c15-14(16,17)12-10-19(6-7-21-12)13(20)9-18-8-11-4-2-1-3-5-11;/h1-5,12,18H,6-10H2;1H |
| InChIKey | QOODAOCILMCKKU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |