C17H19F3N2O3 — CID 167945819
N-[4-[3-oxo-3-[2-(trifluoromethyl)morpholin-4-yl]propyl]phenyl]prop-2-enamide (PubChem CID 167945819) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is N-[4-[3-oxo-3-[2-(trifluoromethyl)morpholin-4-yl]propyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[3-oxo-3-[2-(trifluoromethyl)morpholin-4-yl]propyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167945819 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[4-[3-oxo-3-[2-(trifluoromethyl)morpholin-4-yl]propyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CCC(=O)N2CCOC(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C17H19F3N2O3/c1-2-15(23)21-13-6-3-12(4-7-13)5-8-16(24)22-9-10-25-14(11-22)17(18,19)20/h2-4,6-7,14H,1,5,8-11H2,(H,21,23) |
| InChIKey | NUIYNFMDUKUZGR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|