C20H21N3O3 — CID 166422002
N-[4-[3-oxo-3-(2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-6-yl)propyl]phenyl]prop-2-enamide (PubChem CID 166422002) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[4-[3-oxo-3-(2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-6-yl)propyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[3-oxo-3-(2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-6-yl)propyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166422002 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[4-[3-oxo-3-(2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridin-6-yl)propyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CCC(=O)N2CCc3[nH]c(=O)ccc3C2)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-2-18(24)21-16-7-3-14(4-8-16)5-10-20(26)23-12-11-17-15(13-23)6-9-19(25)22-17/h2-4,6-9H,1,5,10-13H2,(H,21,24)(H,22,25) |
| InChIKey | VCFNGFHMZKIIBB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|