C23H25ClN2O3S — CID 166422006
N-[4-[3-(2-chlorospiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)-3-oxopropyl]phenyl]prop-2-enamide (PubChem CID 166422006) has the molecular formula C23H25ClN2O3S and a molecular weight of 444.98 g/mol. Its IUPAC name is N-[4-[3-(2-chlorospiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)-3-oxopropyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[3-(2-chlorospiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)-3-oxopropyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166422006 |
| Molecular Formula | C23H25ClN2O3S |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[4-[3-(2-chlorospiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)-3-oxopropyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CCC(=O)N2CCC3(CC2)OCCc2cc(Cl)sc23)cc1 |
| InChI | InChI=1S/C23H25ClN2O3S/c1-2-20(27)25-18-6-3-16(4-7-18)5-8-21(28)26-12-10-23(11-13-26)22-17(9-14-29-23)15-19(24)30-22/h2-4,6-7,15H,1,5,8-14H2,(H,25,27) |
| InChIKey | GYAZOXSQRNLBCX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|