C22H19Cl2N3O2S — CID 166427325
N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[4-(prop-2-enoylamino)phenyl]propanamide (PubChem CID 166427325) has the molecular formula C22H19Cl2N3O2S and a molecular weight of 460.39 g/mol. Its IUPAC name is N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[4-(prop-2-enoylamino)phenyl]propanamide.
| Compound Name | N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[4-(prop-2-enoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 166427325 |
| Molecular Formula | C22H19Cl2N3O2S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-[4-(prop-2-enoylamino)phenyl]propanamide |
| SMILES | C=CC(=O)Nc1ccc(CCC(=O)Nc2ncc(Cc3ccc(Cl)c(Cl)c3)s2)cc1 |
| InChI | InChI=1S/C22H19Cl2N3O2S/c1-2-20(28)26-16-7-3-14(4-8-16)6-10-21(29)27-22-25-13-17(30-22)11-15-5-9-18(23)19(24)12-15/h2-5,7-9,12-13H,1,6,10-11H2,(H,26,28)(H,25,27,29) |
| InChIKey | SBXNGHJSSAVRNB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|