C15H11Cl2N3O3S2 — CID 124938588
N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 124938588) has the molecular formula C15H11Cl2N3O3S2 and a molecular weight of 416.31 g/mol. Its IUPAC name is N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 124938588 |
| Molecular Formula | C15H11Cl2N3O3S2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(C[C@H]1SC(=O)NC1=O)Nc1ncc(Cc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C15H11Cl2N3O3S2/c16-9-2-1-7(4-10(9)17)3-8-6-18-14(24-8)19-12(21)5-11-13(22)20-15(23)25-11/h1-2,4,6,11H,3,5H2,(H,18,19,21)(H,20,22,23)/t11-/m1/s1 |
| InChIKey | YPXCRSQVDYDEDW-LLVKDONJSA-N |
| XLogP | 3.72 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|