C8H7N3O3S2 — CID 3298328
2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 3298328) has the molecular formula C8H7N3O3S2 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3298328 |
| Molecular Formula | C8H7N3O3S2 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2-(2,4-dioxo-1,3-thiazolidin-5-yl)-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CC1SC(=O)NC1=O)Nc1nccs1 |
| InChI | InChI=1S/C8H7N3O3S2/c12-5(10-7-9-1-2-15-7)3-4-6(13)11-8(14)16-4/h1-2,4H,3H2,(H,9,10,12)(H,11,13,14) |
| InChIKey | YFRKZKMMGHLXMI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|