C22H20Cl2N2OS — CID 18827705
(E)-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 18827705) has the molecular formula C22H20Cl2N2OS and a molecular weight of 431.39 g/mol. Its IUPAC name is (E)-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18827705 |
| Molecular Formula | C22H20Cl2N2OS |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | (E)-N-[5-[(3,4-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(/C=C/C(=O)Nc2ncc(Cc3ccc(Cl)c(Cl)c3)s2)cc1 |
| InChI | InChI=1S/C22H20Cl2N2OS/c1-14(2)17-7-3-15(4-8-17)6-10-21(27)26-22-25-13-18(28-22)11-16-5-9-19(23)20(24)12-16/h3-10,12-14H,11H2,1-2H3,(H,25,26,27)/b10-6+ |
| InChIKey | ZYTBGMKGRBOCGH-UXBLZVDNSA-N |
| XLogP | 6.82 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|