C20H12Cl3F3N2OS — CID 18827729
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[5-[(3,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 18827729) has the molecular formula C20H12Cl3F3N2OS and a molecular weight of 491.75 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[5-[(3,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[5-[(3,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 18827729 |
| Molecular Formula | C20H12Cl3F3N2OS |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[5-[(3,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(C(F)(F)F)c1)Nc1ncc(Cc2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C20H12Cl3F3N2OS/c21-13-5-12(6-14(22)9-13)7-15-10-27-19(30-15)28-18(29)4-2-11-1-3-17(23)16(8-11)20(24,25)26/h1-6,8-10H,7H2,(H,27,28,29)/b4-2+ |
| InChIKey | AATMNRAGNFCTFL-DUXPYHPUSA-N |
| XLogP | 7.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|