C19H13Cl3N2OS — CID 4229329
3-(4-chlorophenyl)-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 4229329) has the molecular formula C19H13Cl3N2OS and a molecular weight of 423.75 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(4-chlorophenyl)-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4229329 |
| Molecular Formula | C19H13Cl3N2OS |
| Molecular Weight | 423.75 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)Nc1ncc(Cc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C19H13Cl3N2OS/c20-14-4-1-12(2-5-14)3-8-18(25)24-19-23-11-16(26-19)10-13-9-15(21)6-7-17(13)22/h1-9,11H,10H2,(H,23,24,25) |
| InChIKey | JAKFLPHHVUCXGY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.75 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|