C20H14ClF3N2OS — CID 18827601
(E)-N-(5-benzyl-1,3-thiazol-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 18827601) has the molecular formula C20H14ClF3N2OS and a molecular weight of 422.86 g/mol. Its IUPAC name is (E)-N-(5-benzyl-1,3-thiazol-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(5-benzyl-1,3-thiazol-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18827601 |
| Molecular Formula | C20H14ClF3N2OS |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | (E)-N-(5-benzyl-1,3-thiazol-2-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(C(F)(F)F)c1)Nc1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C20H14ClF3N2OS/c21-17-8-6-14(11-16(17)20(22,23)24)7-9-18(27)26-19-25-12-15(28-19)10-13-4-2-1-3-5-13/h1-9,11-12H,10H2,(H,25,26,27)/b9-7+ |
| InChIKey | MXYNQJVXDCUUIQ-VQHVLOKHSA-N |
| XLogP | 6.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|