C20H17ClN2OS — CID 2873182
3-(2-chlorophenyl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 2873182) has the molecular formula C20H17ClN2OS and a molecular weight of 368.89 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2873182 |
| Molecular Formula | C20H17ClN2OS |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | Cc1cccc(Cc2cnc(NC(=O)C=Cc3ccccc3Cl)s2)c1 |
| InChI | InChI=1S/C20H17ClN2OS/c1-14-5-4-6-15(11-14)12-17-13-22-20(25-17)23-19(24)10-9-16-7-2-3-8-18(16)21/h2-11,13H,12H2,1H3,(H,22,23,24) |
| InChIKey | KWEMKSACEVEKGI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|