C19H17ClN2OS — CID 4969220
2-chloro-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-phenylacetamide (PubChem CID 4969220) has the molecular formula C19H17ClN2OS and a molecular weight of 356.88 g/mol. Its IUPAC name is 2-chloro-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-phenylacetamide.
| Compound Name | 2-chloro-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 4969220 |
| Molecular Formula | C19H17ClN2OS |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-chloro-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-phenylacetamide |
| SMILES | Cc1cccc(Cc2cnc(NC(=O)C(Cl)c3ccccc3)s2)c1 |
| InChI | InChI=1S/C19H17ClN2OS/c1-13-6-5-7-14(10-13)11-16-12-21-19(24-16)22-18(23)17(20)15-8-3-2-4-9-15/h2-10,12,17H,11H2,1H3,(H,21,22,23) |
| InChIKey | WPQIFVPINIBYTE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|