C20H19ClN2OS — CID 58033052
(2S)-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-phenylbutanamide (PubChem CID 58033052) has the molecular formula C20H19ClN2OS and a molecular weight of 370.91 g/mol. Its IUPAC name is (2S)-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-phenylbutanamide.
| Compound Name | (2S)-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 58033052 |
| Molecular Formula | C20H19ClN2OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (2S)-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-phenylbutanamide |
| SMILES | CC[C@H](C(=O)Nc1ncc(Cc2cccc(Cl)c2)s1)c1ccccc1 |
| InChI | InChI=1S/C20H19ClN2OS/c1-2-18(15-8-4-3-5-9-15)19(24)23-20-22-13-17(25-20)12-14-7-6-10-16(21)11-14/h3-11,13,18H,2,12H2,1H3,(H,22,23,24)/t18-/m0/s1 |
| InChIKey | HPSVAFHDMZRZKO-SFHVURJKSA-N |
| XLogP | 5.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |