C20H28N2O4S — CID 166421909
N-[4-[3-(2,2-diethyl-1,1-dioxo-1,4-thiazinan-4-yl)-3-oxopropyl]phenyl]prop-2-enamide (PubChem CID 166421909) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is N-[4-[3-(2,2-diethyl-1,1-dioxo-1,4-thiazinan-4-yl)-3-oxopropyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[3-(2,2-diethyl-1,1-dioxo-1,4-thiazinan-4-yl)-3-oxopropyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166421909 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[4-[3-(2,2-diethyl-1,1-dioxo-1,4-thiazinan-4-yl)-3-oxopropyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CCC(=O)N2CCS(=O)(=O)C(CC)(CC)C2)cc1 |
| InChI | InChI=1S/C20H28N2O4S/c1-4-18(23)21-17-10-7-16(8-11-17)9-12-19(24)22-13-14-27(25,26)20(5-2,6-3)15-22/h4,7-8,10-11H,1,5-6,9,12-15H2,2-3H3,(H,21,23) |
| InChIKey | KACKXHDXIAEXRH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|