C12H10F6N2O3 — CID 56862466
6-(trifluoromethyl)-3-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyridin-2-one (PubChem CID 56862466) has the molecular formula C12H10F6N2O3 and a molecular weight of 344.21 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyridin-2-one.
| Compound Name | 6-(trifluoromethyl)-3-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 56862466 |
| Molecular Formula | C12H10F6N2O3 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 6-(trifluoromethyl)-3-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1ccc(C(F)(F)F)[nH]c1=O)N1CCOC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H10F6N2O3/c13-11(14,15)7-2-1-6(9(21)19-7)10(22)20-3-4-23-8(5-20)12(16,17)18/h1-2,8H,3-5H2,(H,19,21) |
| InChIKey | QRSNUWVDSCJHCN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |