C11H12F3N3O3 — CID 56869394
2-methyl-5-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one (PubChem CID 56869394) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-methyl-5-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-5-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 56869394 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-methyl-5-[2-(trifluoromethyl)morpholine-4-carbonyl]-1H-pyrimidin-6-one |
| SMILES | Cc1ncc(C(=O)N2CCOC(C(F)(F)F)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H12F3N3O3/c1-6-15-4-7(9(18)16-6)10(19)17-2-3-20-8(5-17)11(12,13)14/h4,8H,2-3,5H2,1H3,(H,15,16,18) |
| InChIKey | YCALBTLZKZJWFR-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |