About (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone
(5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone (PubChem CID 70710534) has the molecular formula C12H15F3N2O3
and a molecular weight of 292.26 g/mol. Its IUPAC name is (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone.
Molecular Properties
| Compound Name | (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone |
| PubChem CID | 70710534 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone |
| SMILES | CCCc1cc(C(=O)N2CCOC(C(F)(F)F)C2)no1 |
| InChI | InChI=1S/C12H15F3N2O3/c1-2-3-8-6-9(16-20-8)11(18)17-4-5-19-10(7-17)12(13,14)15/h6,10H,2-5,7H2,1H3 |
| InChIKey | PLUDLUIPUWNCIG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone?
The IUPAC name of (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone (CID 70710534) is (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone.
What is the SMILES notation for (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone?
The canonical SMILES for (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone is CCCc1cc(C(=O)N2CCOC(C(F)(F)F)C2)no1.
What is the InChIKey of (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone?
The InChIKey is PLUDLUIPUWNCIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O3/c1-2-3-8-6-9(16-20-8)11(18)17-4-5-19-10(7-17)12(13,14)15/h6,10H,2-5,7H2,1H3.
What are the key properties of (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone?
(5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone has a molecular weight of 292.26 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-propyl-1,2-oxazol-3-yl)-[2-(trifluoromethyl)morpholin-4-yl]methanone is sourced from PubChem (CID 70710534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).