C16H22N4O4 — CID 167887746
diethyl 1-(4-cyano-1-methylpyrazol-5-yl)piperidine-4,4-dicarboxylate (PubChem CID 167887746) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is diethyl 1-(4-cyano-1-methylpyrazol-5-yl)piperidine-4,4-dicarboxylate.
| Compound Name | diethyl 1-(4-cyano-1-methylpyrazol-5-yl)piperidine-4,4-dicarboxylate |
|---|---|
| PubChem CID | 167887746 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | diethyl 1-(4-cyano-1-methylpyrazol-5-yl)piperidine-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCN(c2c(C#N)cnn2C)CC1 |
| InChI | InChI=1S/C16H22N4O4/c1-4-23-14(21)16(15(22)24-5-2)6-8-20(9-7-16)13-12(10-17)11-18-19(13)3/h11H,4-9H2,1-3H3 |
| InChIKey | VRGIJFLYWODVQN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 97.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|