C11H16F3N3 — CID 167890054
1-ethyl-4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidine (PubChem CID 167890054) has the molecular formula C11H16F3N3 and a molecular weight of 247.26 g/mol. Its IUPAC name is 1-ethyl-4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidine.
| Compound Name | 1-ethyl-4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidine |
|---|---|
| PubChem CID | 167890054 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-ethyl-4-[5-(trifluoromethyl)-1H-imidazol-2-yl]piperidine |
| SMILES | CCN1CCC(c2ncc(C(F)(F)F)[nH]2)CC1 |
| InChI | InChI=1S/C11H16F3N3/c1-2-17-5-3-8(4-6-17)10-15-7-9(16-10)11(12,13)14/h7-8H,2-6H2,1H3,(H,15,16) |
| InChIKey | WLTAFEXYMNENJY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |