C19H24FNO4 — CID 167890612
4-[[3-(3-fluorophenyl)-2-hydroxypropyl]carbamoyl]bicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 167890612) has the molecular formula C19H24FNO4 and a molecular weight of 349.40 g/mol. Its IUPAC name is 4-[[3-(3-fluorophenyl)-2-hydroxypropyl]carbamoyl]bicyclo[2.2.2]octane-1-carboxylic acid.
| Compound Name | 4-[[3-(3-fluorophenyl)-2-hydroxypropyl]carbamoyl]bicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 167890612 |
| Molecular Formula | C19H24FNO4 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 4-[[3-(3-fluorophenyl)-2-hydroxypropyl]carbamoyl]bicyclo[2.2.2]octane-1-carboxylic acid |
| SMILES | O=C(O)C12CCC(C(=O)NCC(O)Cc3cccc(F)c3)(CC1)CC2 |
| InChI | InChI=1S/C19H24FNO4/c20-14-3-1-2-13(10-14)11-15(22)12-21-16(23)18-4-7-19(8-5-18,9-6-18)17(24)25/h1-3,10,15,22H,4-9,11-12H2,(H,21,23)(H,24,25) |
| InChIKey | WQXSWQIPXXTZTR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |