C19H19N5O6S2 — CID 167892206
4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]benzenesulfonamide (PubChem CID 167892206) has the molecular formula C19H19N5O6S2 and a molecular weight of 477.52 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]benzenesulfonamide.
| Compound Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 167892206 |
| Molecular Formula | C19H19N5O6S2 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-[5-methyl-2-(4-nitrophenyl)pyrazol-3-yl]benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N3CCCS3(=O)=O)cc2)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H19N5O6S2/c1-14-13-19(23(20-14)16-3-5-17(6-4-16)24(25)26)21-32(29,30)18-9-7-15(8-10-18)22-11-2-12-31(22,27)28/h3-10,13,21H,2,11-12H2,1H3 |
| InChIKey | RUIPWFMMSMKZIY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|