C17H19N3O7S2 — CID 43955516
N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-2-methyl-5-nitrobenzenesulfonamide (PubChem CID 43955516) has the molecular formula C17H19N3O7S2 and a molecular weight of 441.49 g/mol. Its IUPAC name is N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-2-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-2-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43955516 |
| Molecular Formula | C17H19N3O7S2 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | N-[5-(1,1-dioxo-1,2-thiazolidin-2-yl)-2-methoxyphenyl]-2-methyl-5-nitrobenzenesulfonamide |
| SMILES | COc1ccc(N2CCCS2(=O)=O)cc1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C17H19N3O7S2/c1-12-4-5-14(20(21)22)11-17(12)29(25,26)18-15-10-13(6-7-16(15)27-2)19-8-3-9-28(19,23)24/h4-7,10-11,18H,3,8-9H2,1-2H3 |
| InChIKey | AWIYANMTBFPWJY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|