C13H18FN3O4S — CID 167892659
3-[[(3S)-1-ethylpiperidin-3-yl]carbamoyl]-5-fluorosulfonyloxypyridine (PubChem CID 167892659) has the molecular formula C13H18FN3O4S and a molecular weight of 331.37 g/mol. Its IUPAC name is 3-[[(3S)-1-ethylpiperidin-3-yl]carbamoyl]-5-fluorosulfonyloxypyridine.
| Compound Name | 3-[[(3S)-1-ethylpiperidin-3-yl]carbamoyl]-5-fluorosulfonyloxypyridine |
|---|---|
| PubChem CID | 167892659 |
| Molecular Formula | C13H18FN3O4S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[[(3S)-1-ethylpiperidin-3-yl]carbamoyl]-5-fluorosulfonyloxypyridine |
| SMILES | CCN1CCC[C@H](NC(=O)c2cncc(OS(=O)(=O)F)c2)C1 |
| InChI | InChI=1S/C13H18FN3O4S/c1-2-17-5-3-4-11(9-17)16-13(18)10-6-12(8-15-7-10)21-22(14,19)20/h6-8,11H,2-5,9H2,1H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | VVDPZMAZVDVZIN-NSHDSACASA-N |
| XLogP | 0.89 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |