C12H13FN2O4S — CID 166417226
3-(cyclohex-3-en-1-ylcarbamoyl)-5-fluorosulfonyloxypyridine (PubChem CID 166417226) has the molecular formula C12H13FN2O4S and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-(cyclohex-3-en-1-ylcarbamoyl)-5-fluorosulfonyloxypyridine.
| Compound Name | 3-(cyclohex-3-en-1-ylcarbamoyl)-5-fluorosulfonyloxypyridine |
|---|---|
| PubChem CID | 166417226 |
| Molecular Formula | C12H13FN2O4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 3-(cyclohex-3-en-1-ylcarbamoyl)-5-fluorosulfonyloxypyridine |
| SMILES | O=C(NC1CC=CCC1)c1cncc(OS(=O)(=O)F)c1 |
| InChI | InChI=1S/C12H13FN2O4S/c13-20(17,18)19-11-6-9(7-14-8-11)12(16)15-10-4-2-1-3-5-10/h1-2,6-8,10H,3-5H2,(H,15,16) |
| InChIKey | JZFRYJVWKSNHIF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|