C12H13IN2O — CID 97244956
N-[(1S)-cyclohex-3-en-1-yl]-5-iodopyridine-3-carboxamide (PubChem CID 97244956) has the molecular formula C12H13IN2O and a molecular weight of 328.15 g/mol. Its IUPAC name is N-[(1S)-cyclohex-3-en-1-yl]-5-iodopyridine-3-carboxamide.
| Compound Name | N-[(1S)-cyclohex-3-en-1-yl]-5-iodopyridine-3-carboxamide |
|---|---|
| PubChem CID | 97244956 |
| Molecular Formula | C12H13IN2O |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | N-[(1S)-cyclohex-3-en-1-yl]-5-iodopyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CC=CCC1)c1cncc(I)c1 |
| InChI | InChI=1S/C12H13IN2O/c13-10-6-9(7-14-8-10)12(16)15-11-4-2-1-3-5-11/h1-2,6-8,11H,3-5H2,(H,15,16)/t11-/m1/s1 |
| InChIKey | HTEZIDHTDZKDHP-LLVKDONJSA-N |
| XLogP | 2.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|