C13H17FN2O5S — CID 154880990
3-[(2,2-dimethyloxan-4-yl)carbamoyl]-5-fluorosulfonyloxypyridine (PubChem CID 154880990) has the molecular formula C13H17FN2O5S and a molecular weight of 332.35 g/mol. Its IUPAC name is 3-[(2,2-dimethyloxan-4-yl)carbamoyl]-5-fluorosulfonyloxypyridine.
| Compound Name | 3-[(2,2-dimethyloxan-4-yl)carbamoyl]-5-fluorosulfonyloxypyridine |
|---|---|
| PubChem CID | 154880990 |
| Molecular Formula | C13H17FN2O5S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-[(2,2-dimethyloxan-4-yl)carbamoyl]-5-fluorosulfonyloxypyridine |
| SMILES | CC1(C)CC(NC(=O)c2cncc(OS(=O)(=O)F)c2)CCO1 |
| InChI | InChI=1S/C13H17FN2O5S/c1-13(2)6-10(3-4-20-13)16-12(17)9-5-11(8-15-7-9)21-22(14,18)19/h5,7-8,10H,3-4,6H2,1-2H3,(H,16,17) |
| InChIKey | QAUWAKSPMHBPCE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |