C12H8F5N3O4S — CID 167892907
2,3,4,5,6-pentafluoro-N-methyl-N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide (PubChem CID 167892907) has the molecular formula C12H8F5N3O4S and a molecular weight of 385.27 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-methyl-N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-methyl-N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 167892907 |
| Molecular Formula | C12H8F5N3O4S |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-methyl-N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1N(C)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H8F5N3O4S/c1-3-9(11(21)19-12(22)18-3)20(2)25(23,24)10-7(16)5(14)4(13)6(15)8(10)17/h1-2H3,(H2,18,19,21,22) |
| InChIKey | UNIIBEJCTWLRCU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|