C23H27N3O3 — CID 167894250
tert-butyl N-[2-[2-[[(1R)-1-(4-cyanophenyl)ethyl]carbamoyl]phenyl]ethyl]carbamate (PubChem CID 167894250) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[[(1R)-1-(4-cyanophenyl)ethyl]carbamoyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[[(1R)-1-(4-cyanophenyl)ethyl]carbamoyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 167894250 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | tert-butyl N-[2-[2-[[(1R)-1-(4-cyanophenyl)ethyl]carbamoyl]phenyl]ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)c1ccccc1CCNC(=O)OC(C)(C)C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H27N3O3/c1-16(18-11-9-17(15-24)10-12-18)26-21(27)20-8-6-5-7-19(20)13-14-25-22(28)29-23(2,3)4/h5-12,16H,13-14H2,1-4H3,(H,25,28)(H,26,27)/t16-/m1/s1 |
| InChIKey | MNOZIYAZBLXVPR-MRXNPFEDSA-N |
| XLogP | 4.12 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |