About 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide
3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide (PubChem CID 167896306) has the molecular formula C18H26N4O2S
and a molecular weight of 362.50 g/mol. Its IUPAC name is 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide |
| PubChem CID | 167896306 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC(CN2CCN(Cc3cn4ccccc4n3)CC2)C1 |
| InChI | InChI=1S/C18H26N4O2S/c23-25(24)11-3-4-16(15-25)12-20-7-9-21(10-8-20)13-17-14-22-6-2-1-5-18(22)19-17/h1-2,5-6,14,16H,3-4,7-13,15H2 |
| InChIKey | HJPQNZWLBXCTML-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide?
The IUPAC name of 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide (CID 167896306) is 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide.
What is the SMILES notation for 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide?
The canonical SMILES for 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide is O=S1(=O)CCCC(CN2CCN(Cc3cn4ccccc4n3)CC2)C1.
What is the InChIKey of 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide?
The InChIKey is HJPQNZWLBXCTML-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N4O2S/c23-25(24)11-3-4-16(15-25)12-20-7-9-21(10-8-20)13-17-14-22-6-2-1-5-18(22)19-17/h1-2,5-6,14,16H,3-4,7-13,15H2.
What are the key properties of 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide?
3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide has a molecular weight of 362.50 g/mol, XLogP of 1.28, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(imidazo[1,2-a]pyridin-2-ylmethyl)piperazin-1-yl]methyl]thiane 1,1-dioxide is sourced from PubChem (CID 167896306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).