C10H17NO3S — CID 167896851
N-(7-oxaspiro[3.5]nonan-3-yl)ethenesulfonamide (PubChem CID 167896851) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-(7-oxaspiro[3.5]nonan-3-yl)ethenesulfonamide.
| Compound Name | N-(7-oxaspiro[3.5]nonan-3-yl)ethenesulfonamide |
|---|---|
| PubChem CID | 167896851 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-(7-oxaspiro[3.5]nonan-3-yl)ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC1CCC12CCOCC2 |
| InChI | InChI=1S/C10H17NO3S/c1-2-15(12,13)11-9-3-4-10(9)5-7-14-8-6-10/h2,9,11H,1,3-8H2 |
| InChIKey | CDKISVYEOICNJM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |