C17H11ClF5N3O4S — CID 167898216
N-[4-chloro-2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]phenyl]-2,3,4,5,6-pentafluorobenzenesulfonamide (PubChem CID 167898216) has the molecular formula C17H11ClF5N3O4S and a molecular weight of 483.80 g/mol. Its IUPAC name is N-[4-chloro-2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]phenyl]-2,3,4,5,6-pentafluorobenzenesulfonamide.
| Compound Name | N-[4-chloro-2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]phenyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 167898216 |
| Molecular Formula | C17H11ClF5N3O4S |
| Molecular Weight | 483.80 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | N-[4-chloro-2-[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]phenyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
| SMILES | COCCc1noc(-c2cc(Cl)ccc2NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C17H11ClF5N3O4S/c1-29-5-4-10-24-17(30-25-10)8-6-7(18)2-3-9(8)26-31(27,28)16-14(22)12(20)11(19)13(21)15(16)23/h2-3,6,26H,4-5H2,1H3 |
| InChIKey | OIUUQYUUPXIMTG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|