About 3-nitrosobenzamide
3-nitrosobenzamide (PubChem CID 1679) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is 3-nitrosobenzamide.
Molecular Properties
| Compound Name | 3-nitrosobenzamide |
| PubChem CID | 1679 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 3-nitrosobenzamide |
| SMILES | NC(=O)c1cccc(N=O)c1 |
| InChI | InChI=1S/C7H6N2O2/c8-7(10)5-2-1-3-6(4-5)9-11/h1-4H,(H2,8,10) |
| InChIKey | OZUBORKYZRYLSQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-nitrosobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrosobenzamide?
The IUPAC name of 3-nitrosobenzamide (CID 1679) is 3-nitrosobenzamide.
What is the SMILES notation for 3-nitrosobenzamide?
The canonical SMILES for 3-nitrosobenzamide is NC(=O)c1cccc(N=O)c1.
What is the InChIKey of 3-nitrosobenzamide?
The InChIKey is OZUBORKYZRYLSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c8-7(10)5-2-1-3-6(4-5)9-11/h1-4H,(H2,8,10).
What are the key properties of 3-nitrosobenzamide?
3-nitrosobenzamide has a molecular weight of 150.14 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrosobenzamide is sourced from PubChem (CID 1679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).