C22H33FN2O3 — CID 167901145
1-[4-[[5-fluoro-2-(oxolan-2-ylmethoxy)anilino]methyl]piperidin-1-yl]-3-methylbutan-1-one (PubChem CID 167901145) has the molecular formula C22H33FN2O3 and a molecular weight of 392.52 g/mol. Its IUPAC name is 1-[4-[[5-fluoro-2-(oxolan-2-ylmethoxy)anilino]methyl]piperidin-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[4-[[5-fluoro-2-(oxolan-2-ylmethoxy)anilino]methyl]piperidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 167901145 |
| Molecular Formula | C22H33FN2O3 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 1-[4-[[5-fluoro-2-(oxolan-2-ylmethoxy)anilino]methyl]piperidin-1-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCC(CNc2cc(F)ccc2OCC2CCCO2)CC1 |
| InChI | InChI=1S/C22H33FN2O3/c1-16(2)12-22(26)25-9-7-17(8-10-25)14-24-20-13-18(23)5-6-21(20)28-15-19-4-3-11-27-19/h5-6,13,16-17,19,24H,3-4,7-12,14-15H2,1-2H3 |
| InChIKey | ULDZEPQGNCCNHB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |