C16H19F2N3O2S — CID 167901232
2-[3-(2,2-difluoroethyl)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-methylacetamide (PubChem CID 167901232) has the molecular formula C16H19F2N3O2S and a molecular weight of 355.41 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethyl)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-methylacetamide.
| Compound Name | 2-[3-(2,2-difluoroethyl)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 167901232 |
| Molecular Formula | C16H19F2N3O2S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-[3-(2,2-difluoroethyl)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-methylacetamide |
| SMILES | CNC(=O)CC1S/C(=N\c2cc(C)ccc2C)N(CC(F)F)C1=O |
| InChI | InChI=1S/C16H19F2N3O2S/c1-9-4-5-10(2)11(6-9)20-16-21(8-13(17)18)15(23)12(24-16)7-14(22)19-3/h4-6,12-13H,7-8H2,1-3H3,(H,19,22)/b20-16- |
| InChIKey | MQKSBBZEZYNEGU-SILNSSARSA-N |
| XLogP | 2.64 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|