C15H16N4O — CID 167903613
N-(3-ethynylphenyl)-5-(oxan-4-yl)-1H-1,2,4-triazol-3-amine (PubChem CID 167903613) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-5-(oxan-4-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | N-(3-ethynylphenyl)-5-(oxan-4-yl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 167903613 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-(3-ethynylphenyl)-5-(oxan-4-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | C#Cc1cccc(Nc2n[nH]c(C3CCOCC3)n2)c1 |
| InChI | InChI=1S/C15H16N4O/c1-2-11-4-3-5-13(10-11)16-15-17-14(18-19-15)12-6-8-20-9-7-12/h1,3-5,10,12H,6-9H2,(H2,16,17,18,19) |
| InChIKey | JIAOVFOUYLVWFW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|