C22H20FN3O4 — CID 72945807
N-(3-ethynylphenyl)-16-(18F)fluoro-2,5,8,11-tetraoxa-15,17-diazatricyclo[10.8.0.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine (PubChem CID 72945807) has the molecular formula C22H20FN3O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-16-(18F)fluoro-2,5,8,11-tetraoxa-15,17-diazatricyclo[10.8.0.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine.
| Compound Name | N-(3-ethynylphenyl)-16-(18F)fluoro-2,5,8,11-tetraoxa-15,17-diazatricyclo[10.8.0.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine |
|---|---|
| PubChem CID | 72945807 |
| Molecular Formula | C22H20FN3O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-(3-ethynylphenyl)-16-(18F)fluoro-2,5,8,11-tetraoxa-15,17-diazatricyclo[10.8.0.014,19]icosa-1(12),13,15,17,19-pentaen-18-amine |
| SMILES | C#Cc1cccc(Nc2nc([18F])nc3cc4c(cc23)OCCOCCOCCO4)c1 |
| InChI | InChI=1S/C22H20FN3O4/c1-2-15-4-3-5-16(12-15)24-21-17-13-19-20(14-18(17)25-22(23)26-21)30-11-9-28-7-6-27-8-10-29-19/h1,3-5,12-14H,6-11H2,(H,24,25,26)/i23-1 |
| InChIKey | WFQMWJAVOXDMHS-VNRZBHCFSA-N |
| XLogP | 3.30 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|